Products 162046-61-9
CAS 162046-61-9 appears in our catalog under these names: 2-(Trifluoromethoxy)benzoyl chloride, 96%, 2–(Trifluoromethoxy)benzoyl Chloride, 2-(Trifluoromethoxy)benzoyl chloride 98%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 100g, 25g, 1g, 5g.
2-(trifluoromethoxy)benzoyl chloride (CAS 162046-61-9) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 2-(trifluoromethoxy)benzoyl chloride. InChIKey: KSHPWYXAJJCUMJ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 2-(trifluoromethoxy)benzoyl chloride |
| InChIKey | KSHPWYXAJJCUMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2-(Trifluoromethoxy)benzoyl Chloride, Benzoyl chloride, 2-(trifluoromethoxy)-, 2-Trifluoromethoxybenzoyl chloride, 2-(trifluoromethoxy)benzoylchloride, 2-trifluoromethoxy-benzoyl chloride, 2-(trifluoromethoxy)-benzoyl chloride, o-trifluoromethoxybenzoyl chloride, Trifluoromethoxybenzoyl chloride, 2-(trifluor, o-trifluoromethoxybenzoylchloride