CAS 1214375-02-6 appears in our catalog under these names: Methyl 3-chloro-2,4,5-trifluorobenzoate, 98%, Methyl 3-chloro-2,4,5-trifluorobenzoate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 3-chloro-2,4,5-trifluorobenzoate (CAS 1214375-02-6) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: methyl 3-chloro-2,4,5-trifluorobenzoate. InChIKey: MKOVSUSDISTLPH-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | methyl 3-chloro-2,4,5-trifluorobenzoate |
| InChIKey | MKOVSUSDISTLPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)Cl)F)F |
Computed by PubChem (NCBI)