H-Cys(Bzl)-OH, 95%
cas: 3054-01-1 — see every product listed under this CAS number, including other names
H-Cys(Bzl)-OH, 95% (CAS 3054-01-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1141I1-5g |
| cas | 3054-01-1 |
| size | 5g |
| availability | 700g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 275.60 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 102.06 Pln | |
| Fluorochem | 25g | 174.96 Pln | |
| Fluorochem | 100g | 482.14 Pln | |
| Fluorochem | 500g | 1830.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-3-benzylsulfanylpropanoic acid (CAS 3054-01-1) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: (2R)-2-amino-3-benzylsulfanylpropanoic acid. InChIKey: GHBAYRBVXCRIHT-VIFPVBQESA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | (2R)-2-amino-3-benzylsulfanylpropanoic acid |
| InChIKey | GHBAYRBVXCRIHT-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)CSC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)