Products 51494-04-3
CAS 51494-04-3 appears in our catalog under these names: S-Benzyl-DL-cysteine-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, S-Benzyl-DL-cysteine-2,3,3-d3, 99.90%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 5 mg, 10 mg.
2-amino-3-benzylsulfanyl-2,3,3-trideuteriopropanoic acid (CAS 51494-04-3) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 214.30 g/mol. IUPAC name: 2-amino-3-benzylsulfanyl-2,3,3-trideuteriopropanoic acid. InChIKey: GHBAYRBVXCRIHT-DIJYJEBKSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2-amino-3-benzylsulfanyl-2,3,3-trideuteriopropanoic acid |
| InChIKey | GHBAYRBVXCRIHT-DIJYJEBKSA-N |
| SMILES | [2H]C([2H])(C([2H])(C(=O)O)N)SCC1=CC=CC=C1 |
Computed by PubChem (NCBI)