Products 3054-01-1
CAS 3054-01-1 appears in our catalog under these names: S-Benzyl-L-cysteine, 98%, S-Benzyl-L-Cysteine, H–Cys(Bzl)–OH, H-L-Cys(Bzl)-OH, S-Benzyl-L-cysteine, 99% . Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Iris Biotech. Available pack sizes: 100g, 25g, 500g, 5g, on request, 100mg, 10mg, 50mg.
(2R)-2-amino-3-benzylsulfanylpropanoic acid (CAS 3054-01-1) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: (2R)-2-amino-3-benzylsulfanylpropanoic acid. InChIKey: GHBAYRBVXCRIHT-VIFPVBQESA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | (2R)-2-amino-3-benzylsulfanylpropanoic acid |
| InChIKey | GHBAYRBVXCRIHT-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)CSC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)