H-DL-Trp-NH2.HCl, 98%, 98%
cas: 67607-61-8 — see every product listed under this CAS number, including other names
H-DL-Trp-NH2.HCl, 98%, 98% (CAS 67607-61-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBQB-250mg |
| cas | 67607-61-8 |
| size | 250mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 861.20 Pln | |
| Chemat | 10g | 1509.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride (CAS 67607-61-8) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: 2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride. InChIKey: WOBDANBSEWOYKN-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride |
| InChIKey | WOBDANBSEWOYKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)N)N.Cl |
Computed by PubChem (NCBI)