CAS 5022-65-1 appears in our catalog under these names: L-Tryptophanamide Hydrochloride, >95% (HPLC), H-Trp-NH2.HCl/ 99.5% (existing batch purity), H–Trp–NH2·HCl, H-L-Trp-NH2*HCl, L-Tryptophanamide hydrochloride, 95% . Offered by: TRC, TargetMol, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 500mg, 100mg, 25g, 5g, 1g, 250mg, 10g, 500g.
(2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride (CAS 5022-65-1) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: (2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride. InChIKey: WOBDANBSEWOYKN-FVGYRXGTSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride |
| InChIKey | WOBDANBSEWOYKN-FVGYRXGTSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)