cas: 90891-21-7 — see every product listed under this CAS number, including other names
H-HoPhe-OEt.HCl, 98%, 98% (CAS 90891-21-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q11-5g |
| cas | 90891-21-7 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 256.40 Pln | |
| Chemat | 500g | 1089.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (2S)-2-amino-4-phenylbutanoate;hydrochloride (CAS 90891-21-7) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: ethyl (2S)-2-amino-4-phenylbutanoate;hydrochloride. InChIKey: PTFKZMFFSIYCOV-MERQFXBCSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | ethyl (2S)-2-amino-4-phenylbutanoate;hydrochloride |
| InChIKey | PTFKZMFFSIYCOV-MERQFXBCSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)