CAS 90940-54-8 appears in our catalog under these names: (R)–Ethyl 2–amino–4–phenylbutanoate hydrochloride, (R)-Ethyl 2-amino-4-phenylbutanoate hydrochloride, 98%, 98%, (R)-Ethyl 2-amino-4-phenylbutanoate hydrochloride, 98.0%, Ethyl D-homoalaninate hydrochloride, 98%, H-D-HoPhe-OEt·HCl, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 250mg, 1g, 5g, 10 g, 25 g, 5 g.
Ethyl (2R)-2-amino-4-phenylbutanoate;hydrochloride (CAS 90940-54-8) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: ethyl (2R)-2-amino-4-phenylbutanoate;hydrochloride. InChIKey: PTFKZMFFSIYCOV-RFVHGSKJSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | ethyl (2R)-2-amino-4-phenylbutanoate;hydrochloride |
| InChIKey | PTFKZMFFSIYCOV-RFVHGSKJSA-N |
| SMILES | CCOC(=O)[C@@H](CCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)