H-Ser(Bzl)-OMe.HCl, 97%
cas: 19525-87-2 — see every product listed under this CAS number, including other names
H-Ser(Bzl)-OMe.HCl, 97% (CAS 19525-87-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch114TFS-250mg |
| cas | 19525-87-2 |
| size | 250mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 25g | 587.60 Pln | |
| Chemat | 100g | 1730.00 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 269.93 Pln | |
| BLDpharm | 10g | 314.36 Pln | |
| BLDpharm | 25g | 575.38 Pln | |
| BLDpharm | 100g | 2097.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride (CAS 19525-87-2) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: methyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride. InChIKey: UDHSAWHYRXHQJP-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride |
| InChIKey | UDHSAWHYRXHQJP-PPHPATTJSA-N |
| SMILES | COC(=O)[C@H](COCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Ser(Bzl)-Ome,hcL, H-Ser(Bzl)-OMe.HCl, O-Benzyl-L-serine Methyl Ester Hydrochloride, (S)-Methyl 2-amino-3-(benzyloxy)propanoate hydrochloride, H-Ser(Bzl)-OMe HCl, Methyl O-Benzyl-L-serinate Hydrochloride, methyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride, O-benzylserine methyl ester hydrochloride, H-Ser(Bzl)-OMe . HCl, H-Ser(Bzl)-OMe inverted exclamation mark currencyHCl
