CAS 1287651-36-8 appears in our catalog under these names: HMBR/ 99.72% (existing batch purity), HMBR, (Z)-5-(4-Hydroxy-3-methylbenzylidene)-2-thioxothiazolidin-4-one, 98%, 98%, HMBR, 98.43%, HMBR, 97%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
(5Z)-5-[(4-hydroxy-3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 1287651-36-8) is a chemical compound with the molecular formula C11H9NO2S2 and a molecular weight of 251.3 g/mol. IUPAC name: (5Z)-5-[(4-hydroxy-3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: WUYJNCRVBZWAOK-UITAMQMPSA-N.
| Molecular formula | C11H9NO2S2 |
|---|---|
| Molecular weight | 251.3 g/mol |
| IUPAC name | (5Z)-5-[(4-hydroxy-3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | WUYJNCRVBZWAOK-UITAMQMPSA-N |
| SMILES | CC1=C(C=CC(=C1)/C=C\2/C(=O)NC(=S)S2)O |
Computed by PubChem (NCBI)