cas: 52806-53-8 — see every product listed under this CAS number, including other names
Hydroxyflutamide, 97.50% (CAS 52806-53-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM82980P-25mg |
| cas | 52806-53-8 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 427.15 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.50% |
| category | Chemicals |
2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (CAS 52806-53-8) is a chemical compound with the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. IUPAC name: 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide. InChIKey: YPQLFJODEKMJEF-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O4 |
|---|---|
| Molecular weight | 292.21 g/mol |
| IUPAC name | 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | YPQLFJODEKMJEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)O |
Computed by PubChem (NCBI)