cas: 52806-53-8 — see every product listed under this CAS number, including other names
Hydroxyflutamide, 99.90% (CAS 52806-53-8) is a chemical reagent available from Chemat. Available pack sizes: 25 mg, 100 mg, 10 mg, 50 mg, 10mM/1mL, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013272-25 mg |
| cas | 52806-53-8 |
| size | 25 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 mg | 1030.22 Pln | |
| MedChemExpress | 100 mg | 2279.46 Pln | |
| MedChemExpress | 10 mg | 598.33 Pln | |
| MedChemExpress | 50 mg | 1513.20 Pln | |
| MedChemExpress | 10mM/1mL | 435.79 Pln | |
| MedChemExpress | 5 mg | 407.93 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.90% |
2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (CAS 52806-53-8) is a chemical compound with the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. IUPAC name: 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide. InChIKey: YPQLFJODEKMJEF-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O4 |
|---|---|
| Molecular weight | 292.21 g/mol |
| IUPAC name | 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | YPQLFJODEKMJEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)O |
Computed by PubChem (NCBI)