cas: 52806-53-8 — see every product listed under this CAS number, including other names
Propanamide, 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-, 98%, 98% (CAS 52806-53-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HDP-1mg |
| cas | 52806-53-8 |
| size | 1mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 78.80 Pln | |
| Chemat | 10mg | 83.60 Pln | |
| Chemat | 25mg | 88.40 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 597.20 Pln | |
| Chemat | 10g | 990.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (CAS 52806-53-8) is a chemical compound with the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. IUPAC name: 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide. InChIKey: YPQLFJODEKMJEF-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O4 |
|---|---|
| Molecular weight | 292.21 g/mol |
| IUPAC name | 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | YPQLFJODEKMJEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)O |
Computed by PubChem (NCBI)