CAS 1334510-66-5 appears in our catalog under these names: Cyclopenta(fg)tetracene-1,2-dione, 95+%, Cyclopenta(fg)tetracene–1,2–dione, Cyclopenta[fg]tetracene-1,2-dione. Offered by: AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 200mg, 50mg.
Pentacyclo[10.7.1.03,8.09,20.013,18]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaene-10,11-dione (CAS 1334510-66-5) is a chemical compound with the molecular formula C20H10O2 and a molecular weight of 282.3 g/mol. IUPAC name: pentacyclo[10.7.1.03,8.09,20.013,18]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaene-10,11-dione. InChIKey: AYSSMZWWOZPRMT-UHFFFAOYSA-N.
| Molecular formula | C20H10O2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | pentacyclo[10.7.1.03,8.09,20.013,18]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaene-10,11-dione |
| InChIKey | AYSSMZWWOZPRMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=C4C=CC=CC4=C5C3=C2C(=O)C5=O |
Computed by PubChem (NCBI)