Products 71241-25-3

CAS 71241-25-3 is the registry number for Benzo(a)pyrene-7,10-dione. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 2mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

Benzo[a]pyrene-7,10-dione (CAS 71241-25-3) is a chemical compound with the molecular formula C20H10O2 and a molecular weight of 282.3 g/mol. IUPAC name: benzo[a]pyrene-7,10-dione. InChIKey: QBQYVPBQBAJGPL-UHFFFAOYSA-N.

Identity
Molecular formulaC20H10O2
Molecular weight282.3 g/mol
IUPAC namebenzo[a]pyrene-7,10-dione
InChIKeyQBQYVPBQBAJGPL-UHFFFAOYSA-N
SMILESC1=CC2=C3C(=C1)C=CC4=C3C(=CC5=C4C(=O)C=CC5=O)C=C2

Computed by PubChem (NCBI)