CAS 42286-46-4 is the registry number for Benzo(a)pyrene-4,5-quinone, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 5mg.
Benzo[a]pyrene-4,5-dione (CAS 42286-46-4) is a chemical compound with the molecular formula C20H10O2 and a molecular weight of 282.3 g/mol. IUPAC name: benzo[a]pyrene-4,5-dione. InChIKey: HLCJPUJUJMVQRZ-UHFFFAOYSA-N.
| Molecular formula | C20H10O2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | benzo[a]pyrene-4,5-dione |
| InChIKey | HLCJPUJUJMVQRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3=C4C(=CC2=C1)C(=O)C(=O)C5=CC=CC(=C54)C=C3 |
Computed by PubChem (NCBI)