Products 3067-14-9
CAS 3067-14-9 is the registry number for Benzo(a)pyrene-3,6-quinone, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
Benzo[a]pyrene-3,6-dione (CAS 3067-14-9) is a chemical compound with the molecular formula C20H10O2 and a molecular weight of 282.3 g/mol. IUPAC name: benzo[a]pyrene-3,6-dione. InChIKey: MYRYNZSMCVOJHZ-UHFFFAOYSA-N.
| Molecular formula | C20H10O2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | benzo[a]pyrene-3,6-dione |
| InChIKey | MYRYNZSMCVOJHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C(=CC=C5C4=C(C=C3)C=CC5=O)C2=O |
Computed by PubChem (NCBI)
Synonyms:
Benzo(a)pyrene-3,6-quinone, benzo[a]pyrene-3,6-dione, benzo[a]pyrene-3,6-quinone, 3,6-Benzo(a)pyrenequinone, Benzo[pqr]tetraphene-3,6-dione, 3,6-Benzo(a)pyrenedione, Benzo(a)pyrene 3,6-dione, starbld0003247, Benzo(a)pyrene-3,6-dione, radical ion(1-), 3-07-00-04370 (Beilstein Handbook Reference)