cas: 1092790-21-0 — see every product listed under this CAS number, including other names
Isoquinolin-7-ylboronic acid, 98%, 98% (CAS 1092790-21-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119UAG-100mg |
| cas | 1092790-21-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 1960.40 Pln | |
| Chemat | 10g | 3664.40 Pln | |
| Chemat | 25g | 7504.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Isoquinolin-7-ylboronic acid (CAS 1092790-21-0) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-7-ylboronic acid. InChIKey: SVSZHSMOMDNMLS-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-7-ylboronic acid |
| InChIKey | SVSZHSMOMDNMLS-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=CN=C2)(O)O |
Computed by PubChem (NCBI)