CAS 371766-08-4 appears in our catalog under these names: Isoquinoline–5–boronic acid(contains varying amounts of Anhydride), Isoquinoline-5-boronic acid, 97% , 5-Isoquinolineboronic acid 97%, Isoquinolin-5-Ylboronic Acid, 97%, 97%, Isoquinolin-5-ylboronic acid, 96%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g.
Isoquinolin-5-ylboronic acid (CAS 371766-08-4) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-5-ylboronic acid. InChIKey: XKEYHBLSCGBBGU-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-5-ylboronic acid |
| InChIKey | XKEYHBLSCGBBGU-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN=CC2=CC=C1)(O)O |
Computed by PubChem (NCBI)