Products 191162-39-7
CAS 191162-39-7 appears in our catalog under these names: 3-Quinolineboronic Acid, 3–Quinolineboronic acid(contains varying amounts of Anhydride), 3-Quinolineboronic acid/ 95+%, Quinoline-3-boronic acid, 95% , Quinoline-3-boronic Acid (contains varying amounts of Anhydride). Offered by: TRC, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 10g, 2,5g, 25g, 100g, 1g, 5g, 1000g, 500g.
Quinolin-3-ylboronic acid (CAS 191162-39-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-3-ylboronic acid. InChIKey: YGDICLRMNDWZAK-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-3-ylboronic acid |
| InChIKey | YGDICLRMNDWZAK-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2N=C1)(O)O |
Computed by PubChem (NCBI)