cas: 192182-56-2 — see every product listed under this CAS number, including other names
Isoquinoline-4-boronic acid, 95% (CAS 192182-56-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065607-1G |
| cas | 192182-56-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 357.18 Pln | |
| Fluorochem | 10g | 591.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Isoquinolin-4-ylboronic acid (CAS 192182-56-2) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-4-ylboronic acid. InChIKey: GDTOUTKTCGPAGY-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-4-ylboronic acid |
| InChIKey | GDTOUTKTCGPAGY-UHFFFAOYSA-N |
| SMILES | B(C1=CN=CC2=CC=CC=C12)(O)O |
Computed by PubChem (NCBI)