CAS 202475-60-3 appears in our catalog under these names: JANEX–1, JANEX-1/ 98.03% (existing batch purity), WHI-P 131, JANEX-1 98%, JANEX-1, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg, 25mg, 100mg, 200mg.
4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol (CAS 202475-60-3) is a chemical compound with the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. IUPAC name: 4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol. InChIKey: HOZUXBLMYUPGPZ-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O3 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | 4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol |
| InChIKey | HOZUXBLMYUPGPZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)O)OC |
Computed by PubChem (NCBI)