KM91104 98%
cas: 304481-60-5 — see every product listed under this CAS number, including other names
KM91104 98% (CAS 304481-60-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1249487-1mg |
| cas | 304481-60-5 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 142.31 Pln | |
| Ambeed | 5mg | 225.75 Pln | |
| Ambeed | 10mg | 309.19 Pln | |
| Ambeed | 50mg | 759.75 Pln | |
| Ambeed | 100mg | 1215.88 Pln | |
| Ambeed | 250mg | 2005.75 Pln | |
| Ambeed | 1g | 5081.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1249487 |
3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide (CAS 304481-60-5) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide. InChIKey: GWVYHPUGEQGQSF-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide |
| InChIKey | GWVYHPUGEQGQSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NNC(=O)C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)