CAS 304481-60-5 appears in our catalog under these names: KM91104, H+-Atpase inhibitor, 95%, KM 91104, KM 91104/ 99.7% (existing batch purity), KM91104 98%. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, 250mg, 100mg, 1g, 1mg, 10mg, 25mg, 50mg.
3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide (CAS 304481-60-5) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide. InChIKey: GWVYHPUGEQGQSF-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide |
| InChIKey | GWVYHPUGEQGQSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NNC(=O)C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)