KM91104, 99.67%
cas: 304481-60-5 — see every product listed under this CAS number, including other names
KM91104, 99.67% (CAS 304481-60-5) is a chemical reagent available from Chemat. Available pack sizes: 5 mg, 1 mg, 10mM/1mL, 100 mg, 10 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-135474-5 mg |
| cas | 304481-60-5 |
| size | 5 mg |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 mg | 1127.75 Pln | |
| MedChemExpress | 1 mg | 598.33 Pln | |
| MedChemExpress | 10mM/1mL | 1555.00 Pln | |
| MedChemExpress | 100 mg | 8516.35 Pln | |
| MedChemExpress | 10 mg | 1703.60 Pln | |
| MedChemExpress | 50 mg | 5637.07 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.67% |
3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide (CAS 304481-60-5) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide. InChIKey: GWVYHPUGEQGQSF-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide |
| InChIKey | GWVYHPUGEQGQSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NNC(=O)C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)