KM91104, 98%
cas: 304481-60-5 — see every product listed under this CAS number, including other names
KM91104, 98% (CAS 304481-60-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F988222-1MG |
| cas | 304481-60-5 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1mg | 581.06 Pln | |
| Fluorochem | 5mg | 1158.98 Pln | |
| Fluorochem | 10mg | 1794.18 Pln | |
| Fluorochem | 50mg | 6110.37 Pln | |
| Fluorochem | 100mg | 9265.51 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide (CAS 304481-60-5) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide. InChIKey: GWVYHPUGEQGQSF-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide |
| InChIKey | GWVYHPUGEQGQSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NNC(=O)C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)