cas: 27317-69-7 — see every product listed under this CAS number, including other names
L-Alanine,N-[(1,1-dimethylethoxy)carbonyl]-L-alanyl-, 97%, 97% (CAS 27317-69-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BBYD-500g |
| cas | 27317-69-7 |
| size | 500g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 3849.60 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 189.20 Pln | |
| Chemat | 25g | 362.00 Pln | |
| Chemat | 100g | 952.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid (CAS 27317-69-7) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid. InChIKey: BZNDDHWTEVCBAD-BQBZGAKWSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid |
| InChIKey | BZNDDHWTEVCBAD-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)