cas: 27317-69-7 — see every product listed under this CAS number, including other names
Boc-Ala-Ala-OH, 97% (CAS 27317-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F492780-1G |
| cas | 27317-69-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 1127.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid (CAS 27317-69-7) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid. InChIKey: BZNDDHWTEVCBAD-BQBZGAKWSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid |
| InChIKey | BZNDDHWTEVCBAD-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)