cas: 21282-08-6 — see every product listed under this CAS number, including other names
L-Pyroglutamyl-L-alanine (CAS 21282-08-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F492966-250MG |
| cas | 21282-08-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 732.05 Pln | |
| Fluorochem | 5g | 7948.26 Pln |
| delivery time | 3-4 weeks |
|---|
(2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid (CAS 21282-08-6) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid. InChIKey: YIJVJUARZXCJJP-WHFBIAKZSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid |
| InChIKey | YIJVJUARZXCJJP-WHFBIAKZSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@@H]1CCC(=O)N1 |
Computed by PubChem (NCBI)