CAS 204634-20-8 appears in our catalog under these names: L-Tryptophan-15N2, >95% (HPLC), L–Tryptophan–15N2, L-TRYPTROPHAN-15N2, 95 ATOM % 15N, 95% &, L-Tryptophan-15N2, 98% 98atom%15N, 98% 98atom%15N, L-Tryptophan-15N2, 99.9%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 250MG, 1mg, 5mg, 1 mg, 5 mg.
(2S)-2-(15N)azanyl-3-(1H-indol-3-yl)propanoic acid (CAS 204634-20-8) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 206.21 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-(1H-indol-3-yl)propanoic acid. InChIKey: QIVBCDIJIAJPQS-BGQAPUEUSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | QIVBCDIJIAJPQS-BGQAPUEUSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C[15NH]2)C[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)