Products 202406-50-6
CAS 202406-50-6 appears in our catalog under these names: L-Tryptophan-13C11-15N2, >95% (HPLC), L–Tryptophan–13C11,15N2, L-Tryptophan-13C11,15N2, 98.89%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 2,5mg, 1 mg, 5 mg.
(2S)-2-(15N)azanyl-3-(1H-indol-3-yl)(1,2,3-13C3)propanoic acid (CAS 202406-50-6) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 217.13 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-(1H-indol-3-yl)(1,2,3-13C3)propanoic acid. InChIKey: QIVBCDIJIAJPQS-ODOYFPBQSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-(1H-indol-3-yl)(1,2,3-13C3)propanoic acid |
| InChIKey | QIVBCDIJIAJPQS-ODOYFPBQSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]2[13C](=[13CH]1)[13C](=[13CH][15NH]2)[13CH2][13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)