CAS 1202359-57-6 appears in our catalog under these names: D-Tryptophan-2',4',5',6',7'-d5 (indole-d5), 98 atom % D, min 98% Chemical Purity, D-Tryptophan-d5, >95% (HPLC), H-D-Trp-OH-d5, 99.98%. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 25mg, 50mg, 5mg, 10 mg, 5 mg, 1 mg.
(2R)-2-amino-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid (CAS 1202359-57-6) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 209.26 g/mol. IUPAC name: (2R)-2-amino-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid. InChIKey: QIVBCDIJIAJPQS-BZVPBINISA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 209.26 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
| InChIKey | QIVBCDIJIAJPQS-BZVPBINISA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])C[C@H](C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)