Products 1233395-85-1
CAS 1233395-85-1 appears in our catalog under these names: DL-Tryptophan-d8, 98 atom % D, min 98% Chemical Purity, DL-Tryptophan-d8, DL-Tryptophan-d8, 99.64%. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 0,5mg, 1mg, 5mg, 1 mg, 5 mg, 10 mg.
2-amino-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid (CAS 1233395-85-1) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 212.27 g/mol. IUPAC name: 2-amino-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid. InChIKey: QIVBCDIJIAJPQS-JLAWCNLZSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 2-amino-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
| InChIKey | QIVBCDIJIAJPQS-JLAWCNLZSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])C([2H])([2H])C([2H])(C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)