CAS 133519-78-5 appears in our catalog under these names: L–Tryptophan–d3, L-Tryptophan-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, L-Tryptophan-d3, >95% (HPLC), L-Tryptophan-d3, 99.98%. Offered by: GLPBio, CDN, TRC, MedChemExpress. Available pack sizes: 5mg, 0,05g, 0,01g, 1mg, 25mg, 10mg, 1 mg, 5 mg.
(2S)-2-amino-2,3,3-trideuterio-3-(1H-indol-3-yl)propanoic acid (CAS 133519-78-5) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 207.24 g/mol. IUPAC name: (2S)-2-amino-2,3,3-trideuterio-3-(1H-indol-3-yl)propanoic acid. InChIKey: QIVBCDIJIAJPQS-PKHUVNBJSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 207.24 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3-trideuterio-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | QIVBCDIJIAJPQS-PKHUVNBJSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C1=CNC2=CC=CC=C21)N |
Computed by PubChem (NCBI)