Products 92562-88-4
CAS 92562-88-4 appears in our catalog under these names: Lagociclovir/ 98.9% (existing batch purity), Lagociclovir (MIV–210), 2',3'-Dideoxy-3'-fluoroguanosine, Lagociclovir, 99.33% ,, 99.33% ,, Lagociclovir. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 2mg, 1 mg.
2-amino-9-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 92562-88-4) is a chemical compound with the molecular formula C10H12FN5O3 and a molecular weight of 269.23 g/mol. IUPAC name: 2-amino-9-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: RTJUXLYUUDBAJN-KVQBGUIXSA-N.
| Molecular formula | C10H12FN5O3 |
|---|---|
| Molecular weight | 269.23 g/mol |
| IUPAC name | 2-amino-9-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | RTJUXLYUUDBAJN-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)CO)F |
Computed by PubChem (NCBI)