CAS 73-78-9 appears in our catalog under these names: Lidocaine hydrochloride/ 99.83% (existing batch purity), Lidocaine hydrochloride, Lidocaine (hydrochloride), 99.90%, LIDOCAINE HCL, ≥98%. Offered by: TargetMol, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: 500mg, 25g, 50g, 5 g, 10 g, 500 mg, 10mM/1mL, 5g.
2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;hydrochloride (CAS 73-78-9) is a chemical compound with the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. IUPAC name: 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;hydrochloride. InChIKey: IYBQHJMYDGVZRY-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O |
|---|---|
| Molecular weight | 270.80 g/mol |
| IUPAC name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;hydrochloride |
| InChIKey | IYBQHJMYDGVZRY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C.Cl |
Computed by PubChem (NCBI)