Products 61221-41-8
CAS 61221-41-8 appears in our catalog under these names: Ungeremine acetate, Lycobetaine acetate/ 99.87% (existing batch purity), Lycobetaine, Lycobetaine acetate. Offered by: GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 20mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
5,7-dioxa-12-azoniapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),9,11,15(19),16-heptaen-17-ol acetate (CAS 61221-41-8) is a chemical compound with the molecular formula C18H15NO5 and a molecular weight of 325.3 g/mol. IUPAC name: 5,7-dioxa-12-azoniapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),9,11,15(19),16-heptaen-17-ol acetate. InChIKey: HKIJKEFVQKXWGW-UHFFFAOYSA-N.
| Molecular formula | C18H15NO5 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | 5,7-dioxa-12-azoniapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),9,11,15(19),16-heptaen-17-ol acetate |
| InChIKey | HKIJKEFVQKXWGW-UHFFFAOYSA-N |
| SMILES | CC(=O)[O-].C1C[N+]2=CC3=CC4=C(C=C3C5=CC(=CC1=C52)O)OCO4 |
Computed by PubChem (NCBI)