cas: 28532-21-0 — see every product listed under this CAS number, including other names
MC4033 (CAS 28532-21-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13A39G-1mg |
| cas | 28532-21-0 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 280.40 Pln | |
| Chemat | 5mg | 549.20 Pln | |
| Chemat | 10mg | 851.60 Pln | |
| Chemat | 25mg | 1605.20 Pln | |
| Chemat | 50mg | 2368.40 Pln | |
| Chemat | 100mg | 3424.40 Pln | |
| Chemat | 500mg | 6856.40 Pln |
| delivery time | 3 weeks |
|---|
4-[(4Z)-3-methyl-5-oxo-4-(1H-pyrrol-2-ylmethylidene)pyrazol-1-yl]benzoic acid (CAS 28532-21-0) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 295.29 g/mol. IUPAC name: 4-[(4Z)-3-methyl-5-oxo-4-(1H-pyrrol-2-ylmethylidene)pyrazol-1-yl]benzoic acid. InChIKey: WBHVGUYXAZIVHV-ZROIWOOFSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 4-[(4Z)-3-methyl-5-oxo-4-(1H-pyrrol-2-ylmethylidene)pyrazol-1-yl]benzoic acid |
| InChIKey | WBHVGUYXAZIVHV-ZROIWOOFSA-N |
| SMILES | CC\1=NN(C(=O)/C1=C\C2=CC=CN2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)