CAS 1286787-80-1 appears in our catalog under these names: Mebendazole–d8, Mebendazole-d8. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
Trideuteriomethyl N-[6-(2,3,4,5,6-pentadeuteriobenzoyl)-1H-benzimidazol-2-yl]carbamate (CAS 1286787-80-1) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 303.34 g/mol. IUPAC name: trideuteriomethyl N-[6-(2,3,4,5,6-pentadeuteriobenzoyl)-1H-benzimidazol-2-yl]carbamate. InChIKey: OPXLLQIJSORQAM-JGUCLWPXSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 303.34 g/mol |
| IUPAC name | trideuteriomethyl N-[6-(2,3,4,5,6-pentadeuteriobenzoyl)-1H-benzimidazol-2-yl]carbamate |
| InChIKey | OPXLLQIJSORQAM-JGUCLWPXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=CC3=C(C=C2)N=C(N3)NC(=O)OC([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)