Products 1346600-84-7
CAS 1346600-84-7 appears in our catalog under these names: Nimetazepam-d3, Nimetazepam-d3 (1.0 mg/ml in Methanol). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
7-nitro-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one (CAS 1346600-84-7) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 298.31 g/mol. IUPAC name: 7-nitro-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one. InChIKey: GWUSZQUVEVMBPI-FIBGUPNXSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 298.31 g/mol |
| IUPAC name | 7-nitro-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | GWUSZQUVEVMBPI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)[N+](=O)[O-])C3=CC=CC=C3 |
Computed by PubChem (NCBI)