CAS 2883704-45-6 appears in our catalog under these names: 3-(6-Aminonaphtho[1,2-d]isoxazol-1-yl)piperidine-2,6-dione, 98%, E3 ligase Ligand 38. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
3-(6-aminobenzo[e][1,2]benzoxazol-1-yl)piperidine-2,6-dione (CAS 2883704-45-6) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 295.29 g/mol. IUPAC name: 3-(6-aminobenzo[e][1,2]benzoxazol-1-yl)piperidine-2,6-dione. InChIKey: WSQKSINVRWWVOH-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 3-(6-aminobenzo[e][1,2]benzoxazol-1-yl)piperidine-2,6-dione |
| InChIKey | WSQKSINVRWWVOH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NOC3=C2C4=C(C=C3)C(=CC=C4)N |
Computed by PubChem (NCBI)