CAS 1173021-87-8 appears in our catalog under these names: Mebendazole-d8, >95% (HPLC), Mebendazole D3, Mebendazole–d3, Mebendazole-d3, MEBENDAZOLE-D3 VETRANAL. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 1x10mg, 5 mg, 10 mg.
Trideuteriomethyl N-(6-benzoyl-1H-benzimidazol-2-yl)carbamate (CAS 1173021-87-8) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 298.31 g/mol. IUPAC name: trideuteriomethyl N-(6-benzoyl-1H-benzimidazol-2-yl)carbamate. InChIKey: OPXLLQIJSORQAM-FIBGUPNXSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 298.31 g/mol |
| IUPAC name | trideuteriomethyl N-(6-benzoyl-1H-benzimidazol-2-yl)carbamate |
| InChIKey | OPXLLQIJSORQAM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)