CAS 2412745-63-0 is the registry number for 3-(7-Aminonaphtho[1,2-d]isoxazol-1-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(7-aminobenzo[e][1,2]benzoxazol-1-yl)piperidine-2,6-dione (CAS 2412745-63-0) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 295.29 g/mol. IUPAC name: 3-(7-aminobenzo[e][1,2]benzoxazol-1-yl)piperidine-2,6-dione. InChIKey: BGKDVKUIKHFJHR-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 3-(7-aminobenzo[e][1,2]benzoxazol-1-yl)piperidine-2,6-dione |
| InChIKey | BGKDVKUIKHFJHR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NOC3=C2C4=C(C=C3)C=C(C=C4)N |
Computed by PubChem (NCBI)