CAS 1227572-51-1 is the registry number for 3-Nitro-4-(trifluoromethyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(bromomethyl)-2-nitro-1-(trifluoromethyl)benzene (CAS 1227572-51-1) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: 4-(bromomethyl)-2-nitro-1-(trifluoromethyl)benzene. InChIKey: SKRDWOWZDLGNCO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | 4-(bromomethyl)-2-nitro-1-(trifluoromethyl)benzene |
| InChIKey | SKRDWOWZDLGNCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)