Products 50419-85-7
CAS 50419-85-7 appears in our catalog under these names: 2-Amino-5-bromo-3-(trifluoromethyl)benzoic acid, 95%, 2-Amino-5-bromo-3-(trifluoromethyl)benzoic acid, 97%, 2-Amino-5-bromo-3-(trifluoromethyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,5g.
2-amino-5-bromo-3-(trifluoromethyl)benzoic acid (CAS 50419-85-7) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: 2-amino-5-bromo-3-(trifluoromethyl)benzoic acid. InChIKey: DQEHUKWTOSTBGZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | 2-amino-5-bromo-3-(trifluoromethyl)benzoic acid |
| InChIKey | DQEHUKWTOSTBGZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)C(F)(F)F)Br |
Computed by PubChem (NCBI)