Products 1208076-77-0
CAS 1208076-77-0 appears in our catalog under these names: 4-Amino-5-bromo-2-(trifluoromethyl)benzoic acid, 98%, 4-Amino-5-bromo-2-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
4-amino-5-bromo-2-(trifluoromethyl)benzoic acid (CAS 1208076-77-0) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: 4-amino-5-bromo-2-(trifluoromethyl)benzoic acid. InChIKey: WXUDGCIRGQCIKP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | 4-amino-5-bromo-2-(trifluoromethyl)benzoic acid |
| InChIKey | WXUDGCIRGQCIKP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)N)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)