CAS 162333-02-0 appears in our catalog under these names: 2-Nitro-4-(trifluoromethyl)benzyl bromide, 95%, 2-Nitro-4-(trifluoromethyl)benzyl bromide, 97% , 2-Nitro-4-(trifluoromethyl)benzyl bromide, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
1-(bromomethyl)-2-nitro-4-(trifluoromethyl)benzene (CAS 162333-02-0) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: 1-(bromomethyl)-2-nitro-4-(trifluoromethyl)benzene. InChIKey: XAEZZJSUMIHJQS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | XAEZZJSUMIHJQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)