cas: 49742-56-5 — see every product listed under this CAS number, including other names
METHYL 4'-METHYLBIPHENYL-4-CARBOXYLATE, 95% (CAS 49742-56-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472156-250MG |
| cas | 49742-56-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1757.73 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-(4-methylphenyl)benzoate (CAS 49742-56-5) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: methyl 4-(4-methylphenyl)benzoate. InChIKey: NSUWJKRQGXBISO-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | methyl 4-(4-methylphenyl)benzoate |
| InChIKey | NSUWJKRQGXBISO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)