cas: 49742-56-5 — see every product listed under this CAS number, including other names
Methyl 4'-methylbiphenyl-4-carboxylate, 95%, 95% (CAS 49742-56-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0V5-250mg |
| cas | 49742-56-5 |
| size | 250mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 875.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(4-methylphenyl)benzoate (CAS 49742-56-5) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: methyl 4-(4-methylphenyl)benzoate. InChIKey: NSUWJKRQGXBISO-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | methyl 4-(4-methylphenyl)benzoate |
| InChIKey | NSUWJKRQGXBISO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)